| Name | alpha-cyanocinnamic acid |
| Synonyms | Cyanocinnamicacid alpha-cyanocinnamate 2-CYANOCINNAMIC ACID alpha-cyano-cinnamicaci alpha-cyanocinnamic acid ALPHA-CYANOCINNAMIC ACID 2-CYANO-3-PHENYLACRYLIC ACID 2-cyano-3-phenyl-2-propenoate 2-cyano-3-phenyl-2-propenoicaci (2E)-2-cyano-3-phenylprop-2-enoate ALPHA-CYANO-BETA-PHENYLACRYLIC ACID (2E)-2-cyano-3-phenylprop-2-enoic acid (2Z)-2-cyano-3-phenylprop-2-enoic acid |
| CAS | 1011-92-3 |
| EINECS | 213-788-8 |
| InChI | InChI=1/C10H7NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-6H,(H,12,13)/p-1/b9-6+ |
| Molecular Formula | C10H7NO2 |
| Molar Mass | 173.17 |
| Density | 1.285±0.06 g/cm3(Predicted) |
| Melting Point | 181°C |
| Boling Point | 337.9±30.0 °C(Predicted) |
| Flash Point | 158.1°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 3.98E-05mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| BRN | 2329199 |
| pKa | 0.60±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| MDL | MFCD00016813 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| RTECS | GD8562500 |